CAS 10378-22-0
:ethylenediaminetetraacetic acid*trisodium
Description:
Ethylenediaminetetraacetic acid trisodium salt, commonly referred to as EDTA trisodium salt, is a chelating agent widely used in various applications, including biochemistry, medicine, and industrial processes. It is a white, crystalline powder that is highly soluble in water, forming a clear solution. The compound functions by binding to metal ions, effectively sequestering them and preventing them from participating in chemical reactions, which is particularly useful in applications such as metal ion removal and stabilization. EDTA trisodium salt is often utilized in laboratory settings for its ability to maintain metal ion concentrations and in pharmaceuticals for its role in detoxifying heavy metals. Additionally, it is employed in food preservation and cosmetics due to its antioxidant properties. The compound is generally recognized as safe when used appropriately, although excessive exposure can lead to adverse effects. Its stability and effectiveness across a range of pH levels make it a versatile agent in both research and industrial applications.
Formula:C10H17N2Na3O10
InChI:InChI=1/C10H16N2O8.3Na.2H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;2*1H2/q;3*+1;;/p-3
Synonyms:- Sodium 2,2'-({2-[(Carboxylatomethyl)(Carboxymethyl)Amino]Ethyl}Imino)Diacetate Hydrate (3:1:1)
- Trisodium 2-[2-[Carboxymethyl-(2-Oxido-2-Oxo-Ethyl)Amino]Ethyl-(2-Oxido-2-Oxo-Ethyl)Amino]Acetate Dihydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.