CAS 103782-08-7: ALLOSAMIDIN
Description:Allosamidin is a naturally occurring compound classified as a glycosaminoglycan. It is primarily known for its role as an inhibitor of chitinase enzymes, which are involved in the degradation of chitin, a key structural component in the exoskeletons of arthropods and the cell walls of fungi. This characteristic makes allosamidin of interest in agricultural and pharmaceutical applications, particularly for pest control and antifungal treatments. The compound exhibits a complex structure, featuring multiple sugar units linked together, which contributes to its biological activity. Allosamidin has been studied for its potential therapeutic effects, including its ability to modulate immune responses and its role in various biochemical pathways. Its unique properties and mechanisms of action make it a subject of ongoing research in the fields of biochemistry and pharmacology. As with many bioactive compounds, the safety and efficacy of allosamidin in practical applications are subjects of investigation, emphasizing the need for thorough understanding and evaluation in relevant contexts.
Formula:C25H42N4O14
InChI:InChI=1/C25H42N4O14/c1-8(33)26-14-17(36)16(35)11(6-31)39-23(14)42-22-12(7-32)40-24(15(19(22)38)27-9(2)34)41-21-10(5-30)20-13(18(21)37)28-25(43-20)29(3)4/h10-24,30-32,35-38H,5-7H2,1-4H3,(H,26,33)(H,27,34)/t10-,11+,12+,13+,14+,15+,16+,17-,18+,19-,20-,21+,22+,23-,24-/m0/s1
- Synonyms:
- .beta.-D-Allopyranoside, (3aR,4R,5R,6S,6aS)-2-(dimethylamino)-3a,5,6,6a-tetrahydro-4-hydroxy-6-(hydroxymethyl)-4H-cyclopentoxazol-5-yl 2-(acetylamino)-4-O-2-(acetylamino)-2-deoxy-.beta.-D-allopyranosyl-2-deoxy-
- (3aR,4R,5R,6S,6aS)-2-(dimethylamino)-4-hydroxy-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-5-yl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-beta-D-allopyranosyl]-2-deoxy-beta-D-allopyranoside