
CAS 103788-63-2
:4-(Chloromethyl)-2-propyloxazole
Description:
4-(Chloromethyl)-2-propyloxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chloromethyl group (-CH2Cl) at the 4-position and a propyl group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the chloromethyl group, which can participate in nucleophilic substitution reactions. The oxazole moiety can also engage in various chemical transformations, making it a versatile intermediate in organic synthesis. Additionally, compounds like 4-(Chloromethyl)-2-propyloxazole may exhibit biological activity, which can be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, this compound serves as an important building block in the synthesis of more complex organic molecules.
Formula:C7H10ClNO
InChI:InChI=1S/C7H10ClNO/c1-2-3-7-9-6(4-8)5-10-7/h5H,2-4H2,1H3
InChI key:InChIKey=VPIIHGYMVIEXOA-UHFFFAOYSA-N
SMILES:C(CC)C1=NC(CCl)=CO1
Synonyms:- 4-Chloromethyl-2-propyloxazole
- 4-(Chloromethyl)-2-propyloxazole
- Oxazole, 4-(chloromethyl)-2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.