CymitQuimica logo

CAS 103796-65-2

:

3-Amino-4-ethoxybenzamide

Description:
3-Amino-4-ethoxybenzamide is an organic compound characterized by the presence of an amino group (-NH2) and an ethoxy group (-OCH2CH3) attached to a benzamide structure. This compound features a benzene ring substituted at the 3-position with an amino group and at the 4-position with an ethoxy group, which influences its chemical reactivity and solubility. The presence of the amino group makes it a potential site for further chemical modifications, while the ethoxy group can enhance its lipophilicity compared to other similar compounds. 3-Amino-4-ethoxybenzamide may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the compound. Additionally, it may participate in various chemical reactions, including acylation and alkylation, due to the functional groups present. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-2-13-8-4-3-6(9(11)12)5-7(8)10/h3-5H,2,10H2,1H3,(H2,11,12)
InChI key:InChIKey=LWEZLPOWMCXJMG-UHFFFAOYSA-N
SMILES:O(CC)C1=C(N)C=C(C(N)=O)C=C1
Synonyms:
  • Benzamide, 3-amino-4-ethoxy-
  • 3-Amino-4-ethoxybenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.