CymitQuimica logo

CAS 103796-99-2

:

3-ETHOXY-4-METHOXYPHENYLACETONITRILE

Description:
3-Ethoxy-4-methoxyphenylacetonitrile, with the CAS number 103796-99-2, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with both ethoxy and methoxy groups, contributing to its chemical reactivity and solubility properties. The presence of the acetonitrile functional group indicates that it contains a cyano group (-CN) attached to an acetyl moiety, which can influence its polarity and potential interactions in various chemical environments. This compound may exhibit moderate to high lipophilicity due to the alkoxy substituents, making it potentially useful in organic synthesis and pharmaceutical applications. Its specific reactivity can be attributed to the electron-donating effects of the methoxy and ethoxy groups, which can stabilize certain intermediates during chemical reactions. Additionally, the compound's physical properties, such as boiling point and melting point, would depend on its molecular weight and structural configuration, which are essential for understanding its behavior in different solvents and conditions.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c1-3-14-11-8-9(6-7-12)4-5-10(11)13-2/h4-5,8H,3,6H2,1-2H3
SMILES:CCOc1cc(ccc1OC)CC#N
Synonyms:
  • Benzeneacetonitrile, 3-Ethoxy-4-Methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.