CAS 1038-28-4
:()-13-ethyl-3-methoxygona-2,5(10)-dien-17β-ol
Description:
The chemical substance known as "()-13-ethyl-3-methoxygona-2,5(10)-dien-17β-ol," with the CAS number 1038-28-4, is a steroid compound that exhibits characteristics typical of this class of molecules. It features a complex polycyclic structure, which is common among steroids, and includes functional groups such as a methoxy group and a hydroxyl group, contributing to its reactivity and biological activity. This compound is often studied for its potential pharmacological effects, particularly in relation to hormonal activity, as it may interact with steroid receptors in the body. The presence of the ethyl group and the specific configuration at the 17β position suggest that it may have unique properties compared to other steroids. Additionally, its dienic structure indicates potential for reactivity in certain chemical reactions, making it of interest in synthetic organic chemistry. Overall, this compound's characteristics make it a subject of interest in both medicinal chemistry and biochemistry.
Formula:C20H30O2
InChI:InChI=1/C20H30O2/c1-3-20-11-10-16-15-7-5-14(22-2)12-13(15)4-6-17(16)18(20)8-9-19(20)21/h5,16-19,21H,3-4,6-12H2,1-2H3
InChI key:InChIKey=DKGAZBPXLWEBPI-RHKZOZTBNA-N
SMILES:C(C)[C@@]12[C@]([C@]3([C@](CC1)(C4=C(CC3)CC(OC)=CC4)[H])[H])(CC[C@@H]2O)[H]
Synonyms:- (1)-13-Ethyl-3-methoxygona-2,5(10)-dien-17beta-ol
- (±)-3-Methoxy-18-methylestra-2,5(10)-dien-17β-ol
- 13-ethyl-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (non-preferred name)
- Gona-2,5(10)-dien-17-ol, 13-ethyl-3-methoxy-, (17β)-(±)-
- Gona-2,5(10)-dien-17β-ol, 13-ethyl-3-methoxy-, (±)-
- (±)-13-Ethyl-3-methoxygona-2,5(10)-dien-17β-ol
- (8R,9S,13S,14S,17S)-13-ethyl-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol
- Einecs 213-860-9
- (?-13-ethyl-3-methoxygona-2,5(10)-dien-17?-ol
- (±)-13-ethyl-3-methoxygona-2,5(10)-dien-17beta-ol
- Levonorgestrel IMpurity Q
- dl-3-methoxy-13β-ethylgona-2,5(10)-dien-17β-ol
- Levonorgestrel EP impurity Q
- Levonorgestrel Impurity 17(Levonorgestrel EP Impurity Q)
- Levonorgestrel EP IMP Q
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
13-Ethyl-3-methoxygona-2,5(10)-dien-17β-ol
CAS:Controlled Product13-Ethyl-3-methoxygona-2,5(10)-dien-17β-ol is an analog of a naturally occurring hormone that has been shown to have anticancer properties. It induces apoptosis in human cancer cells and inhibits tumor growth. This compound also has the ability to inhibit hyaluronan synthesis, which is important for cancer cell proliferation and migration. Additionally, 13-Ethyl-3-methoxygona-2,5(10)-dien-17β-ol has been studied as a potential inhibitor of somatostatin kinases, which play a role in regulating cell division and growth. In Chinese hamster ovary cells, this compound was found to be a potent kinase inhibitor that could potentially be used as an anticancer agent. 13-Ethyl-3-methoxygona-2,5(10)-dien-17β-ol is excreted in urine and may have potential therapeuticFormula:C20H30O2Purity:Min. 95%Molecular weight:302.5 g/mol

