CymitQuimica logo

CAS 103824-19-7

:

5-(1-Naphthalenyl)-2(1H)-pyrimidinone

Description:
5-(1-Naphthalenyl)-2(1H)-pyrimidinone, with the CAS number 103824-19-7, is an organic compound characterized by its unique structure that combines a pyrimidinone ring with a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential fluorescence due to the naphthalene component. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the hydrophobic nature of the naphthalene group. The presence of the pyrimidinone ring suggests potential biological activity, as pyrimidine derivatives are often explored for their pharmacological properties. Additionally, the compound may participate in various chemical reactions typical of both aromatic and heterocyclic compounds, such as electrophilic substitution and nucleophilic addition. Its specific applications and reactivity would depend on the functional groups present and the overall molecular environment. As with many organic compounds, safety data should be consulted for handling and usage, particularly regarding toxicity and environmental impact.
Formula:C14H10N2O
InChI:InChI=1S/C14H10N2O/c17-14-15-8-11(9-16-14)13-7-3-5-10-4-1-2-6-12(10)13/h1-9H,(H,15,16,17)
InChI key:InChIKey=YYZLHHQCUOWSSH-UHFFFAOYSA-N
SMILES:O=C1NC=C(C=2C3=C(C=CC2)C=CC=C3)C=N1
Synonyms:
  • 5-(1-Naphthalenyl)-2(1H)-pyrimidinone
  • 2-Hydroxy-5-(naphthalen-1-yl)pyrimidine
  • 2(1H)-Pyrimidinone, 5-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.