CAS 103827-16-3
:histamine trifluoromethyl-toluidide
Description:
Histamine trifluoromethyl-toluidide, identified by its CAS number 103827-16-3, is a chemical compound that features a histamine core structure modified with a trifluoromethyl group and a toluidine moiety. This compound is characterized by its potential biological activity, particularly in relation to histamine receptors, which are involved in various physiological processes, including immune responses and neurotransmission. The trifluoromethyl group enhances the lipophilicity of the molecule, potentially influencing its pharmacokinetic properties and interactions with biological targets. The presence of the toluidine group may also contribute to the compound's overall reactivity and stability. As a derivative of histamine, this compound may exhibit properties relevant to allergy and inflammation research, as well as potential applications in medicinal chemistry. However, specific details regarding its solubility, melting point, and other physical properties would require further investigation or experimental data. Overall, histamine trifluoromethyl-toluidide represents a unique modification of a biologically significant molecule, warranting further study in the context of pharmacology and biochemistry.
Formula:C19H25F3N4O
InChI:InChI=1/C19H25F3N4O/c1-14(24-11-10-17-12-23-13-25-17)4-2-3-5-18(27)26-16-8-6-15(7-9-16)19(20,21)22/h6-9,12-14,24H,2-5,10-11H2,1H3,(H,23,25)(H,26,27)
InChI key:InChIKey=PMKJGGBYYNEYPA-UHFFFAOYSA-N
SMILES:N(C(CCCCC(NCCC1=CN=CN1)C)=O)C2=CC=C(C(F)(F)F)C=C2
Synonyms:- 6-{[2-(1H-imidazol-5-yl)ethyl]amino}-N-[4-(trifluoromethyl)phenyl]heptanamide
- Heptanamide, 6-((2-(1H-imidazol-4-yl)ethyl)amino)-N-(4-(trifluoromethyl)phenyl)-
- Heptanamide, 6-[[2-(1H-imidazol-5-yl)ethyl]amino]-N-[4-(trifluoromethyl)phenyl]-
- Htfmt
- Histamine trifluoromethyl-toluidide
- HTMT
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.