CAS 103827-30-1
:thioridazine N-oxide
Description:
Thioridazine N-oxide is a chemical compound that is a derivative of thioridazine, an antipsychotic medication primarily used to treat schizophrenia. As an N-oxide, it features an oxygen atom bonded to the nitrogen atom of the thioridazine structure, which can influence its pharmacological properties and metabolic profile. The compound is characterized by its molecular structure, which includes a thiazine ring and various substituents that contribute to its biological activity. Thioridazine N-oxide is known to exhibit lower toxicity compared to its parent compound, and it may have different receptor binding affinities, potentially affecting its therapeutic efficacy and side effect profile. The compound is typically studied in the context of drug metabolism and pharmacokinetics, as well as its role in the overall therapeutic effects of thioridazine. As with many pharmaceutical compounds, safety and efficacy are paramount, and ongoing research continues to elucidate its characteristics and potential applications in clinical settings.
Formula:C21H26N2OS2
InChI:InChI=1/C21H26N2OS2/c1-23(24)14-6-5-7-16(23)12-13-22-18-8-3-4-9-20(18)26-21-11-10-17(25-2)15-19(21)22/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
SMILES:CN1(=O)CCCCC1CCN1c2ccccc2Sc2ccc(cc12)SC
Synonyms:- 10-[2-(1-methyl-1-oxidopiperidin-2-yl)ethyl]-2-(methylsulfanyl)-10H-phenothiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
