
CAS 1038385-71-5
:1-Cyclohexyl-1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylic acid
Description:
1-Cyclohexyl-1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a quinoxaline ring system fused with a cyclohexyl group and a carboxylic acid functional group. This compound features a tetrahydro configuration, indicating the presence of four hydrogenated carbon atoms in the ring structure, contributing to its stability and reactivity. The dioxo groups suggest the presence of two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The carboxylic acid group enhances its solubility in polar solvents and can engage in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a complex structure with potential applications in medicinal chemistry.
Formula:C15H16N2O4
InChI:InChI=1S/C15H16N2O4/c18-13-14(19)17(10-4-2-1-3-5-10)12-7-6-9(15(20)21)8-11(12)16-13/h6-8,10H,1-5H2,(H,16,18)(H,20,21)
InChI key:InChIKey=ZJGMRKNWMMOLSQ-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(=CC(C(O)=O)=CC2)NC1=O)C3CCCCC3
Synonyms:- 6-Quinoxalinecarboxylic acid, 1-cyclohexyl-1,2,3,4-tetrahydro-2,3-dioxo-
- 1-Cyclohexyl-1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.