CymitQuimica logo

CAS 1038387-94-8

:

1,2-Dimethyl-1H-benzimidazole-6-methanol

Description:
1,2-Dimethyl-1H-benzimidazole-6-methanol is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two methyl groups and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. The presence of the dimethyl substituents can influence its electronic properties and reactivity, potentially enhancing its biological activity. Benzimidazole derivatives are known for their diverse pharmacological properties, including antifungal, antiviral, and anticancer activities. The specific interactions and stability of 1,2-Dimethyl-1H-benzimidazole-6-methanol can be influenced by factors such as pH, temperature, and the presence of other chemical species. As with many organic compounds, its behavior in various environments can be studied through techniques such as spectroscopy and chromatography, which help elucidate its potential applications in medicinal chemistry and material science.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-7-11-9-4-3-8(6-13)5-10(9)12(7)2/h3-5,13H,6H2,1-2H3
InChI key:InChIKey=KTAKEFLDQMBCPL-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C)=CC=C(CO)C2
Synonyms:
  • (1,2-Dimethyl-1H-1,3-benzodiazol-6-yl)methanol
  • 1,2-Dimethyl-1H-benzimidazole-6-methanol
  • 1,2-Dimethylbenzimidazole-6-methanol
  • 1H-Benzimidazole-6-methanol, 1,2-dimethyl-
  • (2,3-Dimethyl-3H-benzimidazol-5-yl)-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.