CymitQuimica logo

CAS 1038387-95-9

:

1,2-Dimethyl-1H-benzimidazole-6-methanamine

Description:
1,2-Dimethyl-1H-benzimidazole-6-methanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two methyl groups and a methanamine group. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and solubility. The presence of the benzimidazole moiety suggests potential biological activity, as many benzimidazole derivatives are known for their pharmacological properties, including antifungal and antiparasitic effects. The methyl substitutions can enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. Additionally, the amine group may participate in hydrogen bonding, influencing the compound's solubility in various solvents. Overall, 1,2-Dimethyl-1H-benzimidazole-6-methanamine is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents. Its specific applications and behavior would depend on further studies and characterization in various chemical environments.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-7-12-9-4-3-8(6-11)5-10(9)13(7)2/h3-5H,6,11H2,1-2H3
InChI key:InChIKey=GIKKBNKHCLOZPS-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C)=CC=C(CN)C2
Synonyms:
  • (1,2-Dimethyl-1H-1,3-benzodiazol-6-yl)methanamine
  • 1H-Benzimidazole-6-methanamine, 1,2-dimethyl-
  • 1,2-Dimethyl-1H-benzimidazole-6-methanamine
  • (2,3-Dimethylbenzimidazol-5-yl)methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.