CAS 1038387-96-0
:1,2-Dimethyl-1H-benzimidazole-5-methanamine
Description:
1,2-Dimethyl-1H-benzimidazole-5-methanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two methyl groups and a methanamine group. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the benzimidazole moiety suggests potential biological activity, as many benzimidazole derivatives are known for their pharmacological properties. The methyl substitutions can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets or other chemical species. Additionally, the amine group may participate in hydrogen bonding, enhancing solubility in polar solvents. Overall, 1,2-Dimethyl-1H-benzimidazole-5-methanamine is of interest in medicinal chemistry and material science, with applications that may include drug development and the synthesis of novel materials. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-7-12-9-5-8(6-11)3-4-10(9)13(7)2/h3-5H,6,11H2,1-2H3
InChI key:InChIKey=WGRMSEJGFWVFQW-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(CN)=CC2)N=C1C
Synonyms:- (1,2-Dimethyl-1H-1,3-benzodiazol-5-yl)methanamine
- 1,2-Dimethyl-1H-benzimidazole-5-methanamine
- 1,2-Dimethylbenzimidazole-5-methanamine
- 1H-Benzimidazole-5-methanamine, 1,2-dimethyl-
- (1,2-Dimethylbenzimidazol-5-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.