
CAS 1038389-40-0
:6-(3-Methyl-1H-pyrazol-1-yl)-3-pyridinemethanamine
Description:
6-(3-Methyl-1H-pyrazol-1-yl)-3-pyridinemethanamine is an organic compound characterized by its complex structure, which includes a pyridine ring and a pyrazole moiety. This compound features an amine functional group, contributing to its potential as a building block in medicinal chemistry and drug development. The presence of the methyl group on the pyrazole ring can influence its biological activity and solubility. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in the fields of biochemistry and pharmaceuticals. The molecular interactions of this compound can be influenced by its functional groups, which may engage in hydrogen bonding or other intermolecular forces. Additionally, the compound's stability, reactivity, and potential applications can be assessed through various analytical techniques, including spectroscopy and chromatography. Overall, 6-(3-Methyl-1H-pyrazol-1-yl)-3-pyridinemethanamine represents a class of compounds that may hold significance in therapeutic research and development.
Formula:C10H12N4
InChI:InChI=1S/C10H12N4/c1-8-4-5-14(13-8)10-3-2-9(6-11)7-12-10/h2-5,7H,6,11H2,1H3
InChI key:InChIKey=MGAKYNAOEURKIB-UHFFFAOYSA-N
SMILES:CC1=NN(C=C1)C2=CC=C(CN)C=N2
Synonyms:- [6-(3-Methyl-1H-pyrazol-1-yl)pyridin-3-yl]methanamine
- 6-(3-Methyl-1H-pyrazol-1-yl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, 6-(3-methyl-1H-pyrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.