CAS 10385-30-5

4-benzyloxybutyric acid

Description:

4-Benzyloxybutyric acid is an organic compound characterized by the presence of a butyric acid backbone with a benzyloxy substituent at the fourth carbon position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water. The presence of the benzyloxy group enhances its lipophilicity, which can influence its biological activity and potential applications in medicinal chemistry. 4-Benzyloxybutyric acid may exhibit properties related to neurotransmitter modulation, making it of interest in pharmacological research. Its structure allows for potential interactions with various biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c12-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,12,13)

SMILES: c1ccc(cc1)COCCCC(=O)O

Synonyms:

• 4-(Benzyloxy)Butanoic Acid

4-Benzyloxybutyric acid

CAS: 10385-30-5

Formula: C₁₁H₁₄O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 194.2271

Ref: IN-DA003KTP

4-(Benzyloxy)butanoic Acid

Controlled Product

CAS: 10385-30-5

Applications 4-(Benzyloxy)butanoic acid

Formula: C₁₁H₁₄O₃

Color and Shape: Neat

Molecular weight: 194.23

Ref: TR-B291563

4-(Benzyloxy)butanoic acid

Controlled Product

CAS: 10385-30-5

4-(Benzyloxy)butanoic acid, also known as 4-BABA, is an organic compound that is a white solid. It has a molecular weight of 128.11 and it can be found in the form of its chloride salt. The compound is used in analytical chemistry and has been shown to have potential use in analytical methods. 4-BABA can be synthesized from 2-hydroxyphenylacetic acid which is obtained through alkylation with benzyl bromide. This reaction yields a molecule with one more carbon atom than the starting material, which is called an epoxide. The epoxide reacts with chloride to produce the desired product along with a molecule of hydrogen chloride gas. The process requires catalysts such as palladium(II) acetate and triethylamine or platinum(IV) oxide and triethylamine. 4-(Benzyloxy)butanoic acid has two functional groups: an alcohol group (-OH) and an ether

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-FB153540

4-(Benzyloxy)butanoic acid

CAS: 10385-30-5

Formula: C₁₁H₁₄O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 194.23

Ref: 10-F210237