CymitQuimica logo

CAS 103854-74-6

:

1-(4-METHYLBENZYL)-2-THIOUREA

Description:
1-(4-Methylbenzyl)-2-thiourea is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen atoms. This compound features a 4-methylbenzyl group, indicating that a methyl group is attached to the benzyl moiety at the para position. The molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of sulfur in the thiourea group can impart unique reactivity, making it a candidate for further chemical transformations. Additionally, compounds of this nature may exhibit biological activity, which can be explored for medicinal purposes. Safety data should be consulted for handling and storage, as thiourea derivatives can sometimes pose health risks. Overall, 1-(4-methylbenzyl)-2-thiourea is a compound of interest due to its structural features and potential applications in chemical synthesis and biological research.
Formula:C9H12N2S
InChI:InChI=1/C9H12N2S/c1-7-2-4-8(5-3-7)6-11-9(10)12/h2-5H,6H2,1H3,(H3,10,11,12)
SMILES:Cc1ccc(cc1)CNC(=N)S
Synonyms:
  • 1-(4-Methylbenzyl)thiourea
  • Thiourea, N-[(4-methylphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.