
CAS 103856-59-3
:5-Methyl-2-quinolinecarboxylic acid
Description:
5-Methyl-2-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group (-COOH) and a methyl group (-CH3) at the 5-position of the quinoline ring. It is typically a crystalline solid that is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, 5-Methyl-2-quinolinecarboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-7-3-2-4-9-8(7)5-6-10(12-9)11(13)14/h2-6H,1H3,(H,13,14)
InChI key:InChIKey=OLNYCZXIKIMHBJ-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C(O)=O)C=C2)C=CC1
Synonyms:- 2-Quinolinecarboxylic acid, 5-methyl-
- Quinaldic acid, 5-methyl-
- 5-Methyl-2-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.