CAS 103857-06-3
:3-(dimethylamino)-1-(1-hydroxycyclohexyl)propan-1-one
Description:
3-(Dimethylamino)-1-(1-hydroxycyclohexyl)propan-1-one, also known by its CAS number 103857-06-3, is a chemical compound that belongs to the class of ketones. It features a propanone backbone with a dimethylamino group and a hydroxycyclohexyl substituent, which contributes to its unique properties. This compound is often studied for its potential applications in medicinal chemistry and pharmacology, particularly in the context of psychoactive substances. Its structure suggests it may exhibit interactions with neurotransmitter systems, potentially influencing mood or cognitive functions. The presence of both a hydroxy group and a dimethylamino group indicates that it may engage in hydrogen bonding and exhibit basic properties, which can affect its solubility and reactivity. Safety and handling precautions are essential when working with this compound, as it may pose health risks. Overall, its chemical characteristics make it a subject of interest in various research fields, including organic synthesis and drug development.
Formula:C11H21NO2
InChI:InChI=1/C11H21NO2/c1-12(2)9-6-10(13)11(14)7-4-3-5-8-11/h14H,3-9H2,1-2H3
InChI key:InChIKey=IKTNSNACZWDPHO-UHFFFAOYSA-N
SMILES:C(CCN(C)C)(=O)C1(O)CCCCC1
Synonyms:- 1-Propanone, 3-(Dimethylamino)-1-(1-Hydroxycyclohexyl)-
- 3-(Dimethylamino)-1-(1-hydroxycyclohexyl)-1-propanone
- 3-dimethylamino-1-(1-hydroxy-cyclohexyl)-propan-1-one
- CHEMBRDG-BB 9071461
- 3-(dimethylamino)-1-(1-hydroxycyclohexyl)-1-propanone(SALTDATA: HCl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.