CAS 103857-61-0

2-(2-Chlorobenzyl)succinic acid

Description:

2-(2-Chlorobenzyl)succinic acid is an organic compound characterized by its unique structure, which includes a succinic acid backbone substituted with a 2-chlorobenzyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its carboxylic acid functional groups. The presence of the chlorobenzyl moiety can influence its reactivity and interactions, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, 2-(2-Chlorobenzyl)succinic acid represents a versatile building block in organic synthesis, with implications in medicinal chemistry and material science.

Formula: C₁₁H₁₁ClO₄

InChI: InChI=1S/C11H11ClO4/c12-9-4-2-1-3-7(9)5-8(11(15)16)6-10(13)14/h1-4,8H,5-6H2,(H,13,14)(H,15,16)

InChI key: InChIKey=FTJBLTIWNBZCRC-UHFFFAOYSA-N

SMILES: C(C(CC(O)=O)C(O)=O)C1=C(Cl)C=CC=C1

Synonyms:

• 2-[(2-Chlorophenyl)methyl]butanedioic acid
• Butanedioic acid, [(2-chlorophenyl)methyl]-
• Butanedioic acid, 2-[(2-chlorophenyl)methyl]-
• 2-(2-Chlorobenzyl)succinic acid
• Succinic acid, o-chlorobenzyl-