CAS 103858-37-3: 3-Phenylcyclopentanamine

Description:3-Phenylcyclopentanamine, identified by its CAS number 103858-37-3, is an organic compound characterized by a cyclopentane ring substituted with a phenyl group and an amine functional group. This compound typically exhibits a molecular structure that includes five carbon atoms in the cyclopentane ring and an additional six carbon atoms from the phenyl group, contributing to its overall hydrophobic character. The presence of the amine group introduces basic properties, allowing it to participate in hydrogen bonding and potentially influencing its solubility in polar solvents. 3-Phenylcyclopentanamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the phenyl group, which may affect its interactions in various chemical environments. As with many amines, it may also be sensitive to oxidation and other chemical transformations.

Formula:C₁₁H₁₅N

InChI:InChI=1S/C11H15N/c12-11-7-6-10(8-11)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2

InChI key:InChIKey=ZNMXRCDHEJJIIK-UHFFFAOYSA-N

SMILES:NC1CCC(C=2C=CC=CC2)C1

Synonyms:
3-Phenylcyclopentan-1-amine
Cyclopentanamine, 3-phenyl-
3-Phenylcyclopentanamine
3-Phenyl-cyclopentylamine
Cyclopentylamine, 3-phenyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-Phenylcyclopentan-1-amine REF: 10-F699248CAS: 103858-37-3	95%	- - -	Discontinued product
	3-Phenylcyclopentan-1-amine REF: 3D-DEA85837CAS: 103858-37-3	Min. 95%	- - -	Discontinued product