CymitQuimica logo

CAS 103859-38-7

:

4-(dipropan-2-ylamino)butan-1-ol

Description:
4-(Dipropan-2-ylamino)butan-1-ol, with the CAS number 103859-38-7, is an organic compound characterized by its amine and alcohol functional groups. It features a butanol backbone with a dipropan-2-ylamino substituent, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the presence of the hydroxyl (-OH) group. The dipropan-2-ylamino group enhances its potential as a surfactant or emulsifying agent, making it useful in various industrial applications. Additionally, the presence of both amine and alcohol functionalities suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with other substances. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or as a chemical intermediate. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H23NO
InChI:InChI=1/C10H23NO/c1-9(2)11(10(3)4)7-5-6-8-12/h9-10,12H,5-8H2,1-4H3
SMILES:CC(C)N(CCCCO)C(C)C
Synonyms:
  • 1-Butanol, 4-[Bis(1-Methylethyl)Amino]-
  • 4-(Diisopropylamino)Butan-1-Ol
  • 4-DIISOPROPYLAMINO-1-BUTANOL
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.