CAS 103860-95-3

4-(2-chloro-4-methylsulfanyl-phenyl)-4-oxo-butanoic acid

Description:

4-(2-Chloro-4-methylsulfanyl-phenyl)-4-oxo-butanoic acid, with the CAS number 103860-95-3, is a chemical compound that features a butanoic acid backbone substituted with a chloro and a methylsulfanyl group on a phenyl ring. This compound is characterized by its functional groups, which include a carboxylic acid (-COOH) and a ketone (C=O) within the butanoic acid structure. The presence of the chloro substituent introduces a halogen, which can influence the compound's reactivity and solubility. The methylsulfanyl group contributes to the compound's overall polarity and may affect its biological activity. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to their structural features. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.

Formula: C₁₁H₁₁ClO₃S

InChI: InChI=1/C11H11ClO3S/c1-16-7-2-3-8(9(12)6-7)10(13)4-5-11(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)

SMILES: CSc1ccc(c(c1)Cl)C(=O)CCC(=O)O