CymitQuimica logo

CAS 103862-55-1

:

5-Bromo-8-methoxy-2-methylquinoline

Description:
5-Bromo-8-methoxy-2-methylquinoline is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a bromine atom at the 5-position, a methoxy group (-OCH3) at the 8-position, and a methyl group (-CH3) at the 2-position of the quinoline ring. Its molecular formula typically reflects the presence of these substituents, contributing to its unique chemical properties. The presence of the bromine atom can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The methoxy group may influence the compound's solubility and electronic properties, while the methyl group can affect steric hindrance and overall molecular stability. As with many quinoline derivatives, this compound may exhibit biological activity, making it of interest in pharmacological research. Proper handling and safety measures should be observed due to the potential hazards associated with brominated compounds.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c1-7-3-4-8-9(12)5-6-10(14-2)11(8)13-7/h3-6H,1-2H3
InChI key:MCBRCJBMVOOJFX-UHFFFAOYSA-N
SMILES:Cc1ccc2c(ccc(c2n1)OC)Br
Synonyms:
  • 5-Bromo-8-Methoxy-2-Methyl-Quinoline
  • 5-Bromo-6-Methoxy-2-methylquinoline
  • 5-Bromo-8-methylquinoline
Found 4 products.