CAS 10387-50-5
:O-Prenylumbelliferone
Description:
O-Prenylumbelliferone, with the CAS number 10387-50-5, is a naturally occurring compound belonging to the class of coumarins. It is characterized by a prenyl group attached to the umbelliferone structure, which contributes to its unique chemical properties and biological activities. This compound typically exhibits a yellowish to brownish color and is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but has limited solubility in water. O-Prenylumbelliferone is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and antimicrobial activities, making it of interest in medicinal chemistry and natural product research. Its structure allows for various interactions with biological targets, which may lead to therapeutic applications. Additionally, it is important to handle this compound with care, as with many organic chemicals, due to potential toxicity and environmental impact. Overall, O-Prenylumbelliferone represents a significant compound in the study of natural products and their applications in health and disease.
Formula:C14H14O3
InChI:InChI=1/C14H14O3/c1-10(2)7-8-16-12-5-3-11-4-6-14(15)17-13(11)9-12/h3-7,9H,8H2,1-2H3
InChI key:InChIKey=SMHJTSOVVRGDEO-UHFFFAOYSA-N
SMILES:O(CC=C(C)C)C=1C=C2C(=CC1)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 7-[(3-methyl-2-butenyl)oxy]-
- 2H-1-benzopyran-2-one, 7-[(3-methyl-2-buten-1-yl)oxy]-
- 7-(3,3-Dimethylallyloxy)coumarin
- 7-(3-Methyl-2-butenyloxy) coumarin
- 7-(Isopentenyloxy)coumarin
- 7-Hydroxycoumarin dimethylallyl ether
- 7-O-Prenylumbelliferone
- 7-[(3-Methyl-2-buten-1-yl)oxy]-2H-1-benzopyran-2-one
- Coumarin, 7-[(3-methyl-2-butenyl)oxy]-
- NSC 267697
- O-Prenylumbelliferone
- 7-[(3-Methylbut-2-en-1-yl)oxy]-2H-chromen-2-one
- 7-Prenylumbelliferone
- Dimethylallylumbelliferone, 0-
- 7-Isoprenyloxycoumarin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Prenyloxycoumarin
CAS:7-Prenyloxycoumarin (Nsc267697) is a natural product from Heracleum dissectum,and possess preventive and therapeutic effects on breast cancer.Formula:C14H14O3Purity:99.5% - ≥95%Color and Shape:SolidMolecular weight:230.267-Prenyloxycoumarin
CAS:7-Prenyloxycoumarin is a naturally occurring compound, often categorized as a phytochemical, which is primarily isolated from various plant sources including the Rutaceae family. This compound exhibits intriguing biochemical properties due to its unique molecular structure, primarily the presence of a prenyloxy group attached to the coumarin core. The mode of action of 7-Prenyloxycoumarin primarily involves its ability to interact with biological membranes and proteins, leading to modulation of enzymatic activity and disruption of pathogen cell walls.Formula:C14H14O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:230.26 g/mol




