CAS 103877-02-7
:2-[(4-methoxy-3,5-dimethyl-2-pyridyl)methylsulfanyl]-1H-benzimidazol-5-ol
Description:
2-[(4-methoxy-3,5-dimethyl-2-pyridyl)methylsulfanyl]-1H-benzimidazol-5-ol, with CAS number 103877-02-7, is a chemical compound that belongs to the class of benzimidazoles, which are known for their diverse biological activities. This compound features a benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a methoxy group and a dimethyl-substituted pyridine ring contributes to its unique chemical properties and potential pharmacological effects. The methylsulfanyl group enhances its reactivity and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of anti-cancer and anti-inflammatory therapies. Its solubility, stability, and bioavailability are important characteristics that would need to be evaluated in further studies to assess its therapeutic potential. Overall, this compound exemplifies the complexity and versatility of heterocyclic compounds in medicinal chemistry.
Formula:C16H17N3O2S
InChI:InChI=1/C16H17N3O2S/c1-9-7-17-14(10(2)15(9)21-3)8-22-16-18-12-5-4-11(20)6-13(12)19-16/h4-7,20H,8H2,1-3H3,(H,18,19)
SMILES:Cc1cnc(CSc2nc3ccc(cc3[nH]2)O)c(C)c1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
5-O-Desmethyl Omeprazole Sulfide
CAS:Controlled ProductFormula:C16H17N3O2SColor and Shape:NeatMolecular weight:315.39



