CAS 103877-56-1
:2,5-Difluoro-4-methylbenzoyl chloride
Description:
2,5-Difluoro-4-methylbenzoyl chloride is an organic compound characterized by its aromatic structure, featuring a benzoyl chloride functional group. It contains two fluorine atoms positioned at the 2 and 5 positions of the benzene ring, and a methyl group at the 4 position, contributing to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid, known for its strong electrophilic nature due to the presence of the acyl chloride functional group, which makes it highly reactive towards nucleophiles. It is used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of fluorine atoms can enhance the lipophilicity and metabolic stability of derivatives formed from this compound. Safety precautions are necessary when handling this substance, as it can be corrosive and may release toxic gases upon contact with water or moisture. Proper storage in a cool, dry place, away from incompatible materials, is essential to maintain its stability and integrity.
Formula:C8H5ClF2O
InChI:InChI=1/C8H5ClF2O/c1-4-2-7(11)5(8(9)12)3-6(4)10/h2-3H,1H3
SMILES:Cc1cc(c(cc1F)C(=O)Cl)F
Synonyms:- 2,5-Difluoro-4-Methylbenzoylchloride
- Benzoyl chloride, 2,5-difluoro-4-methyl- (9CI)
- Benzoylchloride, 2,5-difluoro-4-methyl-
- 2,5-DIFLUORO-4-METHYL-BENZOYLCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.