CAS 103877-80-1: 2,5-Difluoro-4-methylbenzoic acid
Description:2,5-Difluoro-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid structure. The fluorine substituents are located at the 2 and 5 positions of the benzene ring, while the methyl group is at the 4 position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it useful in various chemical syntheses and applications. As a benzoic acid derivative, it can participate in typical acid-base reactions and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, its unique substitution pattern may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=PWWMQUUDAAWEBK-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(F)=C(C=C1F)C
- Synonyms:
- Benzoic acid, 2,5-difluoro-4-methyl-
- 2,5-Difluoro-4-methylbenzoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,5-Difluoro-4-methylbenzoic acid REF: IN-DA0038ZXCAS: 103877-80-1 | 97% | 26.00 €~614.00 € | Thu 27 Mar 25 |
![]() | 2,5-Difluoro-4-methylbenzoic acid REF: 54-PC400739CAS: 103877-80-1 | 98+% | 84.00 €~276.00 € | Fri 28 Mar 25 |
![]() | 2,5-Difluoro-4-methylbenzoic acid REF: 10-F037160CAS: 103877-80-1 | 96.0% | 24.00 €~413.00 € | Tue 01 Apr 25 |
![]() | 2,5-Difluoro-4-methylbenzoicacid REF: 3D-FD151137CAS: 103877-80-1 | Min. 95% | - - - | Discontinued product |

2,5-Difluoro-4-methylbenzoic acid
Ref: IN-DA0038ZX
1g | 26.00 € | ||
5g | 56.00 € | ||
10g | 78.00 € | ||
250mg | 26.00 € |

2,5-Difluoro-4-methylbenzoic acid
Ref: 54-PC400739
5g | 84.00 € | ||
25g | 276.00 € |

2,5-Difluoro-4-methylbenzoic acid
Ref: 10-F037160
1g | 24.00 € | ||
5g | 38.00 € | ||
10g | 53.00 € | ||
25g | 117.00 € | ||
100g | 413.00 € |

2,5-Difluoro-4-methylbenzoicacid
Ref: 3D-FD151137
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |