CymitQuimica logo

CAS 103877-80-1

:

2,5-Difluoro-4-methylbenzoic acid

Description:
2,5-Difluoro-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid structure. The fluorine substituents are located at the 2 and 5 positions of the benzene ring, while the methyl group is at the 4 position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it useful in various chemical syntheses and applications. As a benzoic acid derivative, it can participate in typical acid-base reactions and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, its unique substitution pattern may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=PWWMQUUDAAWEBK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=C(C)C(F)=C1
Synonyms:
  • Benzoic acid, 2,5-difluoro-4-methyl-
  • 2,5-Difluoro-4-methylbenzoic acid
Found 4 products.