CAS 103882-85-5
:3Epigemcitabine
Description:
3-Epigemcitabine, with the CAS number 103882-85-5, is a nucleoside analog that is primarily used in the field of cancer treatment. It is a derivative of gemcitabine, which is a well-known chemotherapeutic agent. The structure of 3-epigemcitabine features a modified sugar moiety that enhances its stability and efficacy against certain types of cancer cells. This compound exhibits antitumor activity by interfering with DNA synthesis and repair, ultimately leading to apoptosis in rapidly dividing cells. Its mechanism of action involves incorporation into DNA, which disrupts normal replication processes. Additionally, 3-epigemcitabine has been studied for its potential to overcome resistance mechanisms that cancer cells develop against traditional therapies. The pharmacokinetics of this compound suggest that it may have improved bioavailability and reduced toxicity compared to its parent compound. Ongoing research continues to explore its therapeutic potential and optimal dosing regimens in various cancer types.
Formula:C9H11F2N3O4
InChI:InChI=1/C9H11F2N3O4/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17)/t4-,6?,7-/m1/s1
SMILES:c1cn([C@H]2C(C([C@@H](CO)O2)O)(F)F)c(nc1=N)O
Synonyms:- 4-Amino-1-(Deoxy-2,2-difluoro-D-threo-pentofuranosyl)-2(1H)-pyrimidinon
- (Gemcitabine Impurity
- 3’-Epi Gemcitabine (Gemcitabine Impurity)
- 4-Amino-1-(Deoxy-2,2-difluoro-D-threo-pentofuranosyl)-2(1H)-pyrimidinone
- 4-amino-1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3'-Epi Gemcitabine (Gemcitabine Impurity)
CAS:Applications An impurity from the synthesis of Gemcitabine.
References Haufman, et al.: Science, 145, 585 (1964), Prusoff, et al.: Biochim. Biophys. Acta, 32, 295 (1959)Formula:C9H11F2N3O4Color and Shape:NeatMolecular weight:263.23'-Epi gemcitabine
CAS:3'-Epi-GEMCITABINE is a nucleoside phosphoramidite that is used in the synthesis of DNA and RNA. It is an antiviral agent and also has anticancer activity. 3'-Epi-GEMCITABINE inhibits the growth of cells by inhibiting DNA synthesis, which leads to cell death. The chemical name for 3'-epigemcitabine is 2',3'-dideoxyinosine monophosphate. 3'-Epi-GEMCITABINE can be synthesized from 2',3'-dideoxyinosine monophosphate and 5-bromo-2'-deoxyuridine diphosphate.Formula:C9H11F2N3O4Purity:Min. 95%Molecular weight:263.2 g/mol




