CAS 1038828-38-4

4-Fluoro-2-methyl-L-phenylalanine

Description:

4-Fluoro-2-methyl-L-phenylalanine is an amino acid derivative characterized by the presence of a fluorine atom at the para position of the phenyl ring and a methyl group at the second carbon of the backbone. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can serve as a useful building block in synthetic chemistry and pharmaceutical applications. The fluorine substitution can influence the compound's biological activity, solubility, and stability, making it of interest in drug design and development. Its structure allows for potential interactions with biological targets, which can be exploited in medicinal chemistry. Additionally, the presence of both the fluorine and methyl groups can affect the compound's steric and electronic properties, potentially enhancing its efficacy in various applications. As with many fluorinated compounds, it may exhibit unique pharmacokinetic profiles, making it a subject of study in the context of drug metabolism and bioavailability.

Formula: C₁₀H₁₂FNO₂

InChI: InChI=1S/C10H12FNO2/c1-6-4-8(11)3-2-7(6)5-9(12)10(13)14/h2-4,9H,5,12H2,1H3,(H,13,14)/t9-/m0/s1

InChI key: InChIKey=WDSUDTPFZZINJC-VIFPVBQESA-N

SMILES: C([C@@H](C(O)=O)N)C1=C(C)C=C(F)C=C1

Synonyms:

• 4-Fluoro-2-methyl-L-phenylalanine
• L-Phenylalanine, 4-fluoro-2-methyl-