CAS 103887-39-4
:diphenyl(pyrrolidin-3-yl)acetonitrile
Description:
Diphenyl(pyrrolidin-3-yl)acetonitrile, with the CAS number 103887-39-4, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and two phenyl groups attached to an acetonitrile moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic synthesis and medicinal chemistry. The presence of the nitrile functional group suggests that it may participate in nucleophilic reactions, while the pyrrolidine ring can influence its biological activity and solubility. Diphenyl(pyrrolidin-3-yl)acetonitrile may also display interesting electronic properties due to the conjugation between the phenyl groups and the nitrile, which can affect its reactivity and interaction with other molecules. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Overall, this compound represents a versatile structure that could be of interest in various fields, including pharmaceuticals and materials science.
Formula:C18H18N2
InChI:InChI=1/C18H18N2/c19-14-18(17-11-12-20-13-17,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17,20H,11-13H2
SMILES:c1ccc(cc1)C(C#N)(c1ccccc1)C1CCNC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
alpha,alpha-Diphenyl-3-pyrrolidineacetonitrile
CAS:Controlled ProductFormula:C18H18N2Color and Shape:NeatMolecular weight:262.35
