CAS 103889-37-8

2-Chloro-6-fluorobenzotrifluoride

Description:

2-Chloro-6-fluorobenzotrifluoride, with the CAS number 103889-37-8, is an aromatic compound characterized by the presence of a benzene ring substituted with a chlorine atom, a fluorine atom, and three trifluoromethyl groups. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its stability and resistance to degradation, making it useful in various applications, including as a solvent and in the synthesis of other chemical compounds. The presence of multiple electronegative substituents contributes to its polar nature, affecting its solubility in different solvents. Additionally, 2-Chloro-6-fluorobenzotrifluoride exhibits properties typical of halogenated aromatic compounds, such as potential environmental persistence and bioaccumulation. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.

Formula: C₇H₃ClF₄

InChI: InChI=1/C7H3ClF4/c8-4-2-1-3-5(9)6(4)7(10,11)12/h1-3H

SMILES: c1cc(c(c(c1)F)C(F)(F)F)Cl

Synonyms:

• 1-Chloro-3-Fluoro-2-(Trifluoromethyl)Benzene

1-chloro-3-fluoro-2-(trifluoromethyl)benzene

CAS: 103889-37-8

Formula: C₇H₃ClF₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 198.5453

Ref: IN-DA0039Z7

2-Chloro-6-fluorobenzotrifluoride

CAS: 103889-37-8

2-Chloro-6-fluorobenzotrifluoride

Formula: C₇H₃ClF₄

Purity: 98%

Color and Shape: clear liquid

Molecular weight: 198.55g/mol

Ref: 54-PC4269

1-Chloro-3-fluoro-2-trifluoromethyl-benzene

CAS: 103889-37-8

Formula: C₇H₃ClF₄

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 198.54

Ref: 10-F032863