
CAS 103889-85-6
:Benzeneacetic acid, α-amino-3,5-dimethoxy-, (R)-
Description:
Benzeneacetic acid, α-amino-3,5-dimethoxy-, (R)-, with the CAS number 103889-85-6, is an organic compound characterized by its aromatic structure and the presence of both an amino group and a carboxylic acid functional group. This compound features a benzene ring substituted with a benzeneacetic acid moiety and two methoxy groups at the 3 and 5 positions, contributing to its unique chemical properties. The (R)- designation indicates its specific stereochemistry, which can influence its biological activity and interactions. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents and varying degrees of polarity due to the presence of functional groups. Additionally, the methoxy groups can enhance the compound's lipophilicity and potentially affect its pharmacokinetic profile. As with many amino acids and their derivatives, this compound may play a role in biochemical processes and could be of interest in medicinal chemistry for its potential therapeutic applications.
Formula:C10H13NO4
InChI:InChI=1S/C10H13NO4/c1-14-7-3-6(9(11)10(12)13)4-8(5-7)15-2/h3-5,9H,11H2,1-2H3,(H,12,13)/t9-/m1/s1
InChI key:InChIKey=PUDUIVFPKSOBOR-SECBINFHSA-N
SMILES:[C@@H](C(O)=O)(N)C1=CC(OC)=CC(OC)=C1
Synonyms:- Benzeneacetic acid, α-amino-3,5-dimethoxy-, (R)-
- D-3,5-Dimethoxyphenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.