CAS 1038916-13-0

5-Fluoro-1H-indazole-7-carboxylic acid

Description:

5-Fluoro-1H-indazole-7-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 5-position and a carboxylic acid group at the 7-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. It may exhibit acidic behavior due to the carboxylic group, allowing it to participate in various chemical reactions, such as esterification or amidation. The fluorine substitution can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, its structure may allow for interactions with biological targets, potentially leading to applications in drug development. As with many indazole derivatives, it may also exhibit interesting electronic properties, making it a subject of study in materials science and organic electronics.

Formula: C₈H₅FN₂O₂

InChI: InChI=1S/C8H5FN2O2/c9-5-1-4-3-10-11-7(4)6(2-5)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=MRPARTBZLWCDIU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC(F)=C1)C=NN2

Synonyms:

• 1H-Indazole-7-carboxylic acid, 5-fluoro-
• 5-Fluoro-1H-indazole-7-carboxylic acid