
CAS 1038917-11-1
:rel-N-Cyano-N′′-methyl-N′-[[(2R,5R)-tetrahydro-5-(1H-imidazol-5-yl)-2-furanyl]methyl]guanidine
Description:
Rel-N-Cyano-N′′-methyl-N′-[[(2R,5R)-tetrahydro-5-(1H-imidazol-5-yl)-2-furanyl]methyl]guanidine, identified by its CAS number 1038917-11-1, is a chemical compound characterized by its complex structure, which includes a guanidine moiety and a tetrahydrofuran ring substituted with an imidazole group. This compound is notable for its potential biological activity, particularly in pharmacological applications, where it may exhibit properties such as enzyme inhibition or receptor modulation. The presence of the cyano group suggests potential reactivity, while the guanidine structure may contribute to its ability to form hydrogen bonds, influencing solubility and interaction with biological targets. Its stereochemistry, indicated by the (2R,5R) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different properties. Overall, this compound represents a class of molecules that may be of interest in medicinal chemistry and drug development, warranting further investigation into its pharmacokinetics and therapeutic potential.
Formula:C11H16N6O
InChI:InChI=1/C11H16N6O/c1-13-11(16-6-12)15-4-8-2-3-10(18-8)9-5-14-7-17-9/h5,7-8,10H,2-4H2,1H3,(H,14,17)(H2,13,15,16)/t8-,10-/s2
InChI key:InChIKey=CCOQWVUQXNRKKP-CSEYRULYNA-N
SMILES:C(N=C(NC#N)NC)[C@@H]1O[C@H](CC1)C2=CN=CN2
Synonyms:- Guanidine, N-cyano-N′′-methyl-N′-[[(2R,5R)-tetrahydro-5-(1H-imidazol-5-yl)-2-furanyl]methyl]-, rel-
- rel-N-Cyano-N′′-methyl-N′-[[(2R,5R)-tetrahydro-5-(1H-imidazol-5-yl)-2-furanyl]methyl]guanidine
- OUP 16
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
OUP-16
CAS:<p>OUP-16 is a potent and selective histamine H4 receptor agonist.</p>Formula:C11H16N6OColor and Shape:SolidMolecular weight:248.28
