CAS 103893-37-4
:2-methyl-4-piperidin-1-ylbenzaldehyde
Description:
2-Methyl-4-piperidin-1-ylbenzaldehyde, with the CAS number 103893-37-4, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a piperidine ring. This compound features a methyl group at the second position of the benzene ring and a piperidine moiety at the fourth position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the piperidine ring suggests potential basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in organic solvents and limited solubility in water are typical for such compounds, influencing its applications in synthesis and formulation. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C13H17NO
InChI:InChI=1/C13H17NO/c1-11-9-13(6-5-12(11)10-15)14-7-3-2-4-8-14/h5-6,9-10H,2-4,7-8H2,1H3
SMILES:Cc1cc(ccc1C=O)N1CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
