CAS 103896-91-9
:(2,5-DIMETHYL-PHENOXY)-ACETIC ACID HYDRAZIDE
Description:
(2,5-Dimethyl-phenoxy)-acetic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with a carboxylic acid. This compound features a phenoxy group, indicating the presence of a phenolic structure substituted with two methyl groups at the 2 and 5 positions, enhancing its lipophilicity and potentially influencing its biological activity. The hydrazide moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. It may exhibit properties such as antimicrobial or herbicidal activity, which are common in compounds with similar structures. The presence of the hydrazide group also suggests potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as hydrazides can sometimes be associated with toxicity or reactivity concerns.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-7-3-4-8(2)9(5-7)14-6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:Cc1ccc(C)c(c1)OCC(=NN)O
Synonyms:- Acetic Acid, 2-(2,5-Dimethylphenoxy)-, Hydrazide
- 2-(2,5-Dimethylphenoxy)Acetohydrazide
- (2,5-Dimethyl-phenoxy)-acetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
