CAS 1038968-74-9: 3-Pentyl-5-isoxazolamine

Description: 3-Pentyl-5-isoxazolamine is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. The isoxazole moiety is a five-membered heterocyclic compound containing both nitrogen and oxygen, which can influence the compound's reactivity and interaction with biological targets. The presence of the pentyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and mechanisms of action would depend on further research and characterization, including studies on its efficacy and safety profiles. As with many chemical substances, understanding its structure-activity relationship is crucial for predicting its behavior in biological systems and its potential therapeutic uses. Safety data and handling precautions should be referenced from reliable sources, as with any chemical compound, to ensure proper management in laboratory or industrial settings.

Formula: C₈H₁₄N₂O

InChI: InChI=1S/C8H14N2O/c1-2-3-4-5-7-6-8(9)11-10-7/h6H,2-5,9H2,1H3

InChI key: InChIKey=SWUFZCKNJXQAAH-UHFFFAOYSA-N

SMILES: N=1OC(N)=CC1CCCCC

3-Pentyl-1,2-oxazol-5-amine

CAS: 1038968-74-9

Versatile small molecule scaffold

• Formula: C₈H₁₄N₂O
• Purity: Min. 95%
• Molecular weight: 154.21 g/mol

3-Pentyl-1,2-oxazol-5-amine

CAS: 1038968-74-9

• Purity: 95%
• Molecular weight: 154.21299743652344