CAS 103904-73-0
:2-Hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrien-1-ylbenzoic acid
Description:
2-Hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrien-1-ylbenzoic acid, with CAS number 103904-73-0, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a long-chain polyunsaturated fatty acid derivative. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH), contributing to its potential as a bioactive molecule. The presence of multiple double bonds in the pentadecatrienyl chain indicates that it may exhibit unique physical and chemical properties, such as increased reactivity and potential for biological activity. Its structural configuration suggests it may play a role in various biochemical processes, possibly influencing cell signaling or membrane dynamics. Additionally, the compound's solubility and stability can be affected by the length and degree of unsaturation of the fatty acid chain. Overall, 2-Hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrien-1-ylbenzoic acid is of interest in fields such as biochemistry and pharmacology, where its functional properties may be explored for therapeutic applications.
Formula:C22H30O3
InChI:InChI=1S/C22H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h2,4-5,7-8,15,17-18,23H,1,3,6,9-14,16H2,(H,24,25)/b5-4-,8-7-
InChI key:InChIKey=QUVGEKPNSCFQIR-UTOQUPLUSA-N
SMILES:C(O)(=O)C1=C(CCCCCCC/C=C\C/C=C\CC=C)C=CC=C1O
Synonyms:- Benzoic acid, 2-hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrienyl-
- Benzoic acid, 2-hydroxy-6-(8,11,14-pentadecatrienyl)-, (Z,Z)-
- 2-Hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrien-1-ylbenzoic acid
- (15:3)-Anacardic acid
- Benzoic acid, 2-hydroxy-6-(8Z,11Z)-8,11,14-pentadecatrien-1-yl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(15:3)-Anacardic acid
CAS:<p>(15:3)-Anacardic acid is a useful organic compound for research related to life sciences. The catalog number is T126498 and the CAS number is 103904-73-0.</p>Formula:C22H30O3Color and Shape:SolidMolecular weight:342.4796-[8(Z),11(Z),14(Z)-pentadecatrienyl]-salicylic acid
CAS:Formula:C22H30O3Purity:>98%Color and Shape:SolidMolecular weight:342.476-[8(Z),11(Z),14(Z)-Pentadecatrienyl]-salicylic acid
CAS:<p>6-[8(Z)11(Z),14(Z)-Pentadecatrienyl]salicylic acid (PCA) is a bioactive phytochemical that belongs to the group of polyunsaturated fatty acids. PCA has been shown to induce apoptosis in cells by activating the caspase-independent cell death pathway, which is mediated by activation of pro-apoptotic protein BAX. PCA has been found to inhibit tumor growth in xenograft models and also showed antiviral activity against HIV infection in vitro.</p>Formula:C22H30O3Purity:Min. 95%Molecular weight:342.5 g/mol



