CAS 103904-74-1
:Anacardic acid diene
Description:
Anacardic acid diene, identified by the CAS number 103904-74-1, is a naturally occurring compound derived from the cashew nut shell liquid. It is characterized by its unique structure, which includes a long hydrocarbon chain with multiple unsaturated bonds, specifically a diene configuration. This compound exhibits notable biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in both medicinal and industrial applications. Anacardic acid diene is also known for its potential use as a natural pesticide and in the formulation of various cosmetic products due to its skin-beneficial properties. Its solubility in organic solvents and relatively low solubility in water are typical for compounds with long hydrocarbon chains. Additionally, the presence of functional groups in its structure contributes to its reactivity and interaction with other chemical species. Overall, anacardic acid diene represents a fascinating area of study within the field of natural products and their applications in health and industry.
Formula:C22H32O3
InChI:InChI=1S/C22H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h4-5,7-8,15,17-18,23H,2-3,6,9-14,16H2,1H3,(H,24,25)/b5-4-,8-7-
InChI key:InChIKey=KAOMOVYHGLSFHQ-UTOQUPLUSA-N
SMILES:C(O)(=O)C1=C(CCCCCCC/C=C\C/C=C\CCC)C=CC=C1O
Synonyms:- (15:2)-Anacardic acid
- Benzoic acid, 2-hydroxy-6-(8Z,11Z)-8,11-pentadecadien-1-yl-
- 2-Hydroxy-6-(8Z,11Z)-8,11-pentadecadien-1-ylbenzoic acid
- Benzoic acid, 2-hydroxy-6-(8Z,11Z)-8,11-pentadecadienyl-
- Benzoic acid, 2-hydroxy-6-(8,11-pentadecadienyl)-, (Z,Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Anacardic Acid Diene
CAS:<p>Polyunsaturated anacardic acid diene from cashew shells fights MRSA, S. mutans, and S. mansoni; inhibits soybean lipoxygenase-1.</p>Formula:C22H32O3Color and Shape:SolidMolecular weight:344.492-Hydroxy-6-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzoic acid
CAS:2-Hydroxy-6-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzoic acid is a bioactive compound commonly found in certain plant extracts. It is characterized by its unique structure that couples a hydroxybenzoic acid moiety with an unsaturated alkyl chain. This compound is typically sourced from plants known for their medicinal properties, particularly those that exhibit robust anti-inflammatory responses.Formula:C22H32O3Purity:Min. 95%Molecular weight:344.5 g/mol

