CymitQuimica logo

CAS 103905-49-3

:

4-(DIMETHYLAMINOMETHYL)-6-FLUORO-2-METHOXYPHENOL

Description:
4-(Dimethylaminomethyl)-6-fluoro-2-methoxyphenol, with the CAS number 103905-49-3, is a chemical compound characterized by its unique molecular structure, which includes a fluorine atom and a methoxy group attached to a phenolic ring. This compound typically exhibits properties associated with both aromatic compounds and amines, such as potential solubility in organic solvents and moderate polarity. The presence of the dimethylamino group suggests that it may have basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The fluorine atom can influence the compound's reactivity and stability, often enhancing its lipophilicity. Additionally, the methoxy group can affect the electronic distribution within the molecule, potentially impacting its biological activity. Such compounds may find applications in pharmaceuticals or as intermediates in organic synthesis, although specific applications would depend on further research into their biological properties and reactivity. Safety data and handling precautions should be considered due to the potential toxicity associated with amine-containing compounds.
Formula:C10H14FNO2
InChI:InChI=1S/C10H14FNO2/c1-12(2)6-7-4-8(11)10(13)9(5-7)14-3/h4-5,13H,6H2,1-3H3
InChI key:NOTMCGGOLLFMRG-UHFFFAOYSA-N
SMILES:CN(C)CC1=CC(=C(C(=C1)F)O)OC
Found 2 products.