CymitQuimica logo

CAS 103906-66-7

:

4-chloro-1-(2-chlorophenyl)butan-1-one

Description:
4-Chloro-1-(2-chlorophenyl)butan-1-one, with the CAS number 103906-66-7, is an organic compound characterized by its structure, which includes a butanone backbone substituted with a chloro group and a 2-chlorophenyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of chlorine atoms in its structure contributes to its reactivity, making it a useful building block in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's properties, such as solubility and boiling point, can vary based on the solvent used and the specific conditions of the environment. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods are essential to mitigate any environmental impact.
Formula:C10H10Cl2O
InChI:InChI=1/C10H10Cl2O/c11-7-3-6-10(13)8-4-1-2-5-9(8)12/h1-2,4-5H,3,6-7H2
SMILES:c1ccc(c(c1)C(=O)CCCCl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.