CAS 10391-08-9
:macrocalin A
Description:
Macrocalin A is a naturally occurring compound classified as a flavonoid, specifically a flavonol glycoside. It is derived from various plant sources, particularly those belonging to the genus *Macaranga*. This compound is characterized by its complex structure, which typically includes a flavonoid backbone with sugar moieties attached, contributing to its solubility and biological activity. Macrocalin A exhibits a range of biological properties, including antioxidant, anti-inflammatory, and potential anticancer activities, making it of interest in pharmacological research. Its chemical structure allows it to interact with various biological targets, which may contribute to its therapeutic effects. Additionally, macrocalin A is studied for its role in plant defense mechanisms and its potential applications in nutraceuticals and herbal medicine. As with many natural products, the specific characteristics, including solubility and stability, can vary based on environmental factors and the method of extraction.
Formula:C20H26O5
InChI:InChI=1/C20H26O5/c1-10-11-4-5-12-19(8-11,15(10)21)17(23)25-13-6-7-18(2,3)14-16(22)24-9-20(12,13)14/h11-14,16,22H,1,4-9H2,2-3H3
SMILES:C=C1C2CCC3C(C2)(C1=O)C(=O)OC1CCC(C)(C)C2C(O)OCC312
Synonyms:- Enmein, 13-deoxy-
- 13-hydroxy-1,1-dimethyl-7-methylidenedecahydro-5a,8-methanocyclohepta[c]furo[3,4-e]chromene-5,6(7H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7H-5a,8-Methano-11H-cyclohepta[c]furo[3,4-e][1]benzopyran-5,6-dione,decahydro-13-hydroxy-1,1-dimethyl-7-methylene-,(3aS,5aS,8R,10aS,10bS,13R,13aR)-
CAS:Formula:C20H26O5Purity:98%Color and Shape:SolidMolecular weight:346.4174Isodocarpin
CAS:<p>Isodocarpin is a natural product for research related to life sciences. The catalog number is TN5604 and the CAS number is 10391-08-9.</p>Formula:C20H26O5Color and Shape:SolidMolecular weight:346.423Macrocalin A
CAS:<p>Macrocalin A is an antibiotic, which is derived from Streptomyces bacteria with bactericidal activity. The source of this compound, Streptomyces, is a genus of Gram-positive bacteria known for its rich production of bioactive secondary metabolites. The mode of action of Macrocalin A involves inhibition of cell wall synthesis in target bacteria, specifically by binding to peptidoglycan precursors, thus preventing their incorporation into the cell wall structure. This results in cell lysis and ultimately, bacterial death.</p>Formula:C20H26O5Purity:Min. 95%Molecular weight:346.4 g/mol



