CymitQuimica logo

CAS 103914-61-0

:

6-chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid

Description:
6-Chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a chloro group at the 6-position and a 4-methylphenyl substituent at the 2-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the presence of halogen and aromatic groups may influence its electronic properties and stability. Overall, 6-chloro-2-(4-methylphenyl)quinoline-4-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C17H12ClNO2
InChI:InChI=1/C17H12ClNO2/c1-10-2-4-11(5-3-10)16-9-14(17(20)21)13-8-12(18)6-7-15(13)19-16/h2-9H,1H3,(H,20,21)
SMILES:Cc1ccc(cc1)c1cc(c2cc(ccc2n1)Cl)C(=O)O
Synonyms:
  • 4-Quinolinecarboxylic Acid, 6-Chloro-2-(4-Methylphenyl)-
Found 0 products.