CAS 103918-73-6
:2-Phenylthio-5-propionylphenylacetic acid
Description:
2-Phenylthio-5-propionylphenylacetic acid, identified by its CAS number 103918-73-6, is an organic compound characterized by the presence of both a phenylthio group and a propionyl group attached to a phenylacetic acid backbone. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The phenylthio moiety can enhance lipophilicity, potentially affecting its solubility and biological activity. The propionyl group may influence the compound's reactivity and interactions in biological systems. As with many organic acids, it may exhibit acidic properties, contributing to its behavior in different pH environments. The compound's structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific applications would depend on further research into its biological activity and chemical reactivity. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C17H16O3S
InChI:InChI=1/C17H16O3S/c1-2-15(18)12-8-9-16(13(10-12)11-17(19)20)21-14-6-4-3-5-7-14/h3-10H,2,11H2,1H3,(H,19,20)
SMILES:CCC(=O)c1ccc(c(c1)CC(=O)O)Sc1ccccc1
Synonyms:- 5-Propionyl-2-Thiophenyl-Phenyl Aceticacid/Methyl Ester
- 2-(2-Phenylsulfanyl-5-Propanoyl-Phenyl)Acetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2-(Phenylthio)-5-propionylphenyl)acetic acid
CAS:Formula:C17H16O3SColor and Shape:SolidMolecular weight:300.37212-Phenylthio-5-propionylphenylacetic Acid
CAS:Controlled ProductApplications 2-Phenylthio-5-propionylphenylacetic Acid is a useful synthetic intermediate in the synthesis of Zaltoprofen (Z146000); an inhibitor of Cox-1 and Cox-2. Zaltoprofen preferentially inhibits Cox-2.
References Chen, W., et al.: Faming Zhuanli Shenqing. CN 1986528 A 20070627. Jun 27, 2007; Yamamoto, M., et al.: Chirality, 2, 280 (1990); Inoue, M., et al.: J Pharmacol. Exp. Ther., 293, 662 (2000)Formula:C17H16O3SColor and Shape:NeatMolecular weight:300.37

