
CAS 1039334-68-3
:3-Chloro-4-(1,1-dimethylethoxy)benzenamine
Description:
3-Chloro-4-(1,1-dimethylethoxy)benzenamine is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a bulky 1,1-dimethylethoxy group. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The 1,1-dimethylethoxy group contributes to steric hindrance, potentially affecting the compound's interactions with other molecules and its solubility in various solvents. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can impact its behavior in chemical reactions and biological systems. Additionally, the presence of both the chloro and ether functionalities suggests potential applications in synthesis and as intermediates in the production of more complex molecules. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 3-Chloro-4-(1,1-dimethylethoxy)benzenamine is a compound of interest in organic chemistry and materials science.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-10(2,3)13-9-5-4-7(12)6-8(9)11/h4-6H,12H2,1-3H3
InChI key:InChIKey=UUXBZGOILICMAR-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=C(Cl)C=C(N)C=C1
Synonyms:- 3-Chloro-4-(1,1-dimethylethoxy)benzenamine
- Benzenamine, 3-chloro-4-(1,1-dimethylethoxy)-
- 3-Chloro-4-t-butoxyaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.