CAS 103935-48-4
:3-Bromopropyl 1,1,1-trifluoromethanesulfonate
Description:
3-Bromopropyl 1,1,1-trifluoromethanesulfonate, with the CAS number 103935-48-4, is an organosulfonate compound characterized by the presence of a bromopropyl group and a trifluoromethanesulfonate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the sulfonate group, which is a good leaving group. The trifluoromethanesulfonate group imparts significant electrophilicity, making it useful in various synthetic applications, including the formation of carbon-carbon bonds and the introduction of functional groups in organic synthesis. Additionally, the bromine atom enhances the compound's reactivity, allowing it to participate in further transformations. Safety considerations are important when handling this compound, as it may be harmful if inhaled or ingested, and appropriate protective measures should be taken. Overall, 3-Bromopropyl 1,1,1-trifluoromethanesulfonate serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C4H6BrF3O3S
InChI:InChI=1S/C4H6BrF3O3S/c5-2-1-3-11-12(9,10)4(6,7)8/h1-3H2
InChI key:InChIKey=SEAVCWYCBPZIEO-UHFFFAOYSA-N
SMILES:S(OCCCBr)(C(F)(F)F)(=O)=O
Synonyms:- 3-Bromopropyl 1,1,1-trifluoromethanesulfonate
- 3-Bromopropyl Trifluoromethanesulfonate
- 3-Bromopropyl triflate
- 3-Bromopropyl-1-triflate
- Methanesulfonic acid, 1,1,1-trifluoro-, 3-bromopropyl ester
- Methanesulfonic acid, trifluoro-, 3-bromopropyl ester
- Trifluoromethanesulfonic acid 3-bromopropyl ester
- 3-Bromopropyl-1-trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.