CymitQuimica logo

CAS 1039364-82-3

:

3-Bromo-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine

Description:
3-Bromo-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine framework. This compound features a bromine atom at the 3-position and a phenyl group at the 6-position of the pyrazolo ring, along with an amino group at the 7-position of the pyrimidine moiety. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine substituent can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the amino group may participate in hydrogen bonding, which is crucial for binding interactions in biological systems. This compound may exhibit properties such as anti-inflammatory or anticancer activities, although specific biological data would be necessary to confirm these effects. Overall, 3-Bromo-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine represents a class of compounds that could be explored for therapeutic applications due to their unique structural features.
Formula:C12H9BrN4
InChI:InChI=1S/C12H9BrN4/c13-10-7-16-17-11(14)9(6-15-12(10)17)8-4-2-1-3-5-8/h1-7H,14H2
InChI key:InChIKey=MLSGEOALWRYKSO-UHFFFAOYSA-N
SMILES:NC=1N2C(N=CC1C3=CC=CC=C3)=C(Br)C=N2
Synonyms:
  • Pyrazolo[1,5-a]pyrimidin-7-amine, 3-bromo-6-phenyl-
  • 3-Bromo-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.