CymitQuimica logo

CAS 1039364-83-4

:

3-Bromo-6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-amine

Description:
3-Bromo-6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-amine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a bromine atom at the 3-position and a 4-methoxyphenyl group at the 6-position, contributing to its unique chemical properties. The presence of the amino group at the 7-position enhances its potential for hydrogen bonding and reactivity. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in targeting specific enzymes or receptors. Its molecular structure suggests it may exhibit properties such as anti-inflammatory or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, the presence of the methoxy group can influence its solubility and lipophilicity, affecting its pharmacokinetic profile. Overall, 3-Bromo-6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-amine represents a class of compounds that are of interest for their potential therapeutic applications.
Formula:C13H11BrN4O
InChI:InChI=1S/C13H11BrN4O/c1-19-9-4-2-8(3-5-9)10-6-16-13-11(14)7-17-18(13)12(10)15/h2-7H,15H2,1H3
InChI key:InChIKey=VFRREYJAZLPDHS-UHFFFAOYSA-N
SMILES:NC=1N2C(N=CC1C3=CC=C(OC)C=C3)=C(Br)C=N2
Synonyms:
  • 3-Bromo-6-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-amine
  • Pyrazolo[1,5-a]pyrimidin-7-amine, 3-bromo-6-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.