CAS 1039364-88-9

4-(3-Bromopyrazolo[1,5-a]pyrimidin-6-yl)benzenamine

Description:

4-(3-Bromopyrazolo[1,5-a]pyrimidin-6-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a pyrazolo[1,5-a]pyrimidine moiety and an aniline group. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may also demonstrate interesting properties such as fluorescence or photostability, which can be advantageous in certain applications. Additionally, the presence of both aromatic and heterocyclic components may contribute to its ability to interact with biological targets, making it a candidate for further research in drug discovery and development. As with many chemical substances, safety data and handling precautions should be considered due to potential toxicity or reactivity.

Formula: C₁₂H₉BrN₄

InChI: InChI=1S/C12H9BrN4/c13-11-6-16-17-7-9(5-15-12(11)17)8-1-3-10(14)4-2-8/h1-7H,14H2

InChI key: InChIKey=DKMJFGNFBFLNGW-UHFFFAOYSA-N

SMILES: BrC1=C2N(C=C(C=N2)C3=CC=C(N)C=C3)N=C1

Synonyms:

• 4-(3-Bromopyrazolo[1,5-a]pyrimidin-6-yl)benzenamine
• Benzenamine, 4-(3-bromopyrazolo[1,5-a]pyrimidin-6-yl)-